N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-methylbenzamide
Chemical Structure Depiction of
N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-methylbenzamide
N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-methylbenzamide
Compound characteristics
| Compound ID: | 8208-0206 |
| Compound Name: | N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-methylbenzamide |
| Molecular Weight: | 376.84 |
| Molecular Formula: | C22 H17 Cl N2 O2 |
| Smiles: | Cc1ccc2c(c1)nc(c1ccc(c(c1)NC(c1ccccc1C)=O)[Cl])o2 |
| Stereo: | ACHIRAL |
| logP: | 5.5962 |
| logD: | 5.5923 |
| logSw: | -5.8643 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.442 |
| InChI Key: | QQJYXACKAYIUBF-UHFFFAOYSA-N |