N-[5-oxo-2-phenyl-1-(3-phenylpropyl)-4-(trifluoromethyl)-4,5-dihydro-1H-imidazol-4-yl]cyclohexanecarboxamide
Chemical Structure Depiction of
N-[5-oxo-2-phenyl-1-(3-phenylpropyl)-4-(trifluoromethyl)-4,5-dihydro-1H-imidazol-4-yl]cyclohexanecarboxamide
N-[5-oxo-2-phenyl-1-(3-phenylpropyl)-4-(trifluoromethyl)-4,5-dihydro-1H-imidazol-4-yl]cyclohexanecarboxamide
Compound characteristics
| Compound ID: | 8222-0030 |
| Compound Name: | N-[5-oxo-2-phenyl-1-(3-phenylpropyl)-4-(trifluoromethyl)-4,5-dihydro-1H-imidazol-4-yl]cyclohexanecarboxamide |
| Molecular Weight: | 471.52 |
| Molecular Formula: | C26 H28 F3 N3 O2 |
| Smiles: | C1CCC(CC1)C(NC1(C(N(CCCc2ccccc2)C(c2ccccc2)=N1)=O)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6555 |
| logD: | 3.3079 |
| logSw: | -5.7316 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.837 |
| InChI Key: | QKTHVJNKQZKMMV-VWLOTQADSA-N |