2-[3-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol
Chemical Structure Depiction of
2-[3-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol
2-[3-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol
Compound characteristics
| Compound ID: | 8228-3998 |
| Compound Name: | 2-[3-(4-chlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol |
| Molecular Weight: | 342.8 |
| Molecular Formula: | C16 H11 Cl N4 O S |
| Smiles: | C1C(c2ccccc2O)=Nn2c(c3ccc(cc3)[Cl])nnc2S1 |
| Stereo: | ACHIRAL |
| logP: | 4.7559 |
| logD: | 4.6151 |
| logSw: | -4.6062 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.506 |
| InChI Key: | YJEFYHVNDQAQGD-UHFFFAOYSA-N |