2-[3-(4-tert-butylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol
Chemical Structure Depiction of
2-[3-(4-tert-butylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol
2-[3-(4-tert-butylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol
Compound characteristics
| Compound ID: | 8228-4011 |
| Compound Name: | 2-[3-(4-tert-butylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol |
| Molecular Weight: | 364.47 |
| Molecular Formula: | C20 H20 N4 O S |
| Smiles: | CC(C)(C)c1ccc(cc1)c1nnc2n1N=C(CS2)c1ccccc1O |
| Stereo: | ACHIRAL |
| logP: | 5.9556 |
| logD: | 5.8148 |
| logSw: | -5.4611 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.506 |
| InChI Key: | UHVBYFBRGMJCHS-UHFFFAOYSA-N |