1-(3-chlorophenyl)-3-[4-(morpholin-4-yl)anilino]pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(3-chlorophenyl)-3-[4-(morpholin-4-yl)anilino]pyrrolidine-2,5-dione
1-(3-chlorophenyl)-3-[4-(morpholin-4-yl)anilino]pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8244-0637 |
| Compound Name: | 1-(3-chlorophenyl)-3-[4-(morpholin-4-yl)anilino]pyrrolidine-2,5-dione |
| Molecular Weight: | 385.85 |
| Molecular Formula: | C20 H20 Cl N3 O3 |
| Smiles: | C1C(C(N(C1=O)c1cccc(c1)[Cl])=O)Nc1ccc(cc1)N1CCOCC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2815 |
| logD: | 2.2807 |
| logSw: | -3.4288 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.948 |
| InChI Key: | MVEZEOUOYHGOHS-GOSISDBHSA-N |