7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-8-[(morpholin-4-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione
					Chemical Structure Depiction of
7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-8-[(morpholin-4-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione
			7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-8-[(morpholin-4-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | 8255-0982 | 
| Compound Name: | 7-(3,3-dimethyl-2-oxobutyl)-1,3-dimethyl-8-[(morpholin-4-yl)methyl]-3,7-dihydro-1H-purine-2,6-dione | 
| Molecular Weight: | 377.44 | 
| Molecular Formula: | C18 H27 N5 O4 | 
| Smiles: | CC(C)(C)C(Cn1c2C(N(C)C(N(C)c2nc1CN1CCOCC1)=O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.1009 | 
| logD: | 1.0994 | 
| logSw: | -1.2832 | 
| Hydrogen bond acceptors count: | 9 | 
| Polar surface area: | 68.84 | 
| InChI Key: | OPCVWIUIDYAJLD-UHFFFAOYSA-N | 
 
				 
				