[1-methyl-8-(4-methylphenyl)-2,4-dioxo-1,2,4,6,7,8-hexahydro-3H-imidazo[2,1-f]purin-3-yl]acetic acid
Chemical Structure Depiction of
[1-methyl-8-(4-methylphenyl)-2,4-dioxo-1,2,4,6,7,8-hexahydro-3H-imidazo[2,1-f]purin-3-yl]acetic acid
[1-methyl-8-(4-methylphenyl)-2,4-dioxo-1,2,4,6,7,8-hexahydro-3H-imidazo[2,1-f]purin-3-yl]acetic acid
Compound characteristics
| Compound ID: | 8255-1280 |
| Compound Name: | [1-methyl-8-(4-methylphenyl)-2,4-dioxo-1,2,4,6,7,8-hexahydro-3H-imidazo[2,1-f]purin-3-yl]acetic acid |
| Molecular Weight: | 355.35 |
| Molecular Formula: | C17 H17 N5 O4 |
| Smiles: | Cc1ccc(cc1)N1CCn2c3C(N(CC(O)=O)C(N(C)c3nc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0244 |
| logD: | -2.852 |
| logSw: | -1.8672 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.804 |
| InChI Key: | NDWMSAIEXHDKQD-UHFFFAOYSA-N |