3,4-dimethoxy-N-{2-[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]ethyl}benzene-1-sulfonamide
Chemical Structure Depiction of
3,4-dimethoxy-N-{2-[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]ethyl}benzene-1-sulfonamide
3,4-dimethoxy-N-{2-[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]ethyl}benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8256-0150 |
| Compound Name: | 3,4-dimethoxy-N-{2-[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]ethyl}benzene-1-sulfonamide |
| Molecular Weight: | 421.5 |
| Molecular Formula: | C17 H19 N5 O4 S2 |
| Smiles: | COc1ccc(cc1OC)S(NCCSc1nnnn1c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1559 |
| logD: | 2.1559 |
| logSw: | -2.7425 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 97.021 |
| InChI Key: | UDEIJCCUYJHGMJ-UHFFFAOYSA-N |