N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-(4-chlorophenyl)prop-2-enamide
Chemical Structure Depiction of
N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-(4-chlorophenyl)prop-2-enamide
N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-(4-chlorophenyl)prop-2-enamide
Compound characteristics
| Compound ID: | 8290-03027 |
| Compound Name: | N-[5-(1H-benzimidazol-2-yl)-2-methylphenyl]-3-(4-chlorophenyl)prop-2-enamide |
| Molecular Weight: | 387.87 |
| Molecular Formula: | C23 H18 Cl N3 O |
| Smiles: | Cc1ccc(cc1NC(/C=C/c1ccc(cc1)[Cl])=O)c1nc2ccccc2[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 6.045 |
| logD: | 6.0423 |
| logSw: | -6.3197 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.438 |
| InChI Key: | FQQYOWPHAQIEJL-UHFFFAOYSA-N |