3-amino-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]thieno[3,2-e]pyridine-2-carboxylic acid
Chemical Structure Depiction of
3-amino-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]thieno[3,2-e]pyridine-2-carboxylic acid
3-amino-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]thieno[3,2-e]pyridine-2-carboxylic acid
Compound characteristics
| Compound ID: | 8330-0006 |
| Compound Name: | 3-amino-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]thieno[3,2-e]pyridine-2-carboxylic acid |
| Molecular Weight: | 278.33 |
| Molecular Formula: | C13 H14 N2 O3 S |
| Smiles: | CC1(C)Cc2c(CO1)cc1c(c(C(O)=O)sc1n2)N |
| Stereo: | ACHIRAL |
| logP: | 2.0111 |
| logD: | -2.9924 |
| logSw: | -2.1326 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 66.872 |
| InChI Key: | DNGPWAMYDLWYIC-UHFFFAOYSA-N |