N-[7-(3-chlorophenyl)-5-oxo-5,6,7,8-tetrahydroquinazolin-2-yl]furan-2-carboxamide
Chemical Structure Depiction of
N-[7-(3-chlorophenyl)-5-oxo-5,6,7,8-tetrahydroquinazolin-2-yl]furan-2-carboxamide
N-[7-(3-chlorophenyl)-5-oxo-5,6,7,8-tetrahydroquinazolin-2-yl]furan-2-carboxamide
Compound characteristics
| Compound ID: | 8343-0164 |
| Compound Name: | N-[7-(3-chlorophenyl)-5-oxo-5,6,7,8-tetrahydroquinazolin-2-yl]furan-2-carboxamide |
| Molecular Weight: | 367.79 |
| Molecular Formula: | C19 H14 Cl N3 O3 |
| Smiles: | C1C(Cc2c(cnc(NC(c3ccco3)=O)n2)C1=O)c1cccc(c1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3074 |
| logD: | 2.6403 |
| logSw: | -3.673 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.533 |
| InChI Key: | FNOKSIVFDDZVMD-LBPRGKRZSA-N |