tert-butyl [(1S)-1-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)ethyl]carbamate
Chemical Structure Depiction of
tert-butyl [(1S)-1-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)ethyl]carbamate
tert-butyl [(1S)-1-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)ethyl]carbamate
Compound characteristics
| Compound ID: | 8388-0025 |
| Compound Name: | tert-butyl [(1S)-1-(5-{[(2-chlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)ethyl]carbamate |
| Molecular Weight: | 369.87 |
| Molecular Formula: | C16 H20 Cl N3 O3 S |
| Smiles: | C[C@@H](c1nnc(o1)SCc1ccccc1[Cl])NC(=O)OC(C)(C)C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3988 |
| logD: | 4.3988 |
| logSw: | -4.4653 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.374 |
| InChI Key: | DRVUFJZOMAAETL-JTQLQIEISA-N |