(1S)-1-(5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)-2-phenylethan-1-amine--hydrogen chloride (1/1)
Chemical Structure Depiction of
(1S)-1-(5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)-2-phenylethan-1-amine--hydrogen chloride (1/1)
(1S)-1-(5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)-2-phenylethan-1-amine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 8388-0733 |
| Compound Name: | (1S)-1-(5-{[(3,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-oxadiazol-2-yl)-2-phenylethan-1-amine--hydrogen chloride (1/1) |
| Molecular Weight: | 416.75 |
| Molecular Formula: | C17 H15 Cl2 N3 O S |
| Salt: | HCl |
| Smiles: | C(c1ccccc1)[C@@H](c1nnc(o1)SCc1ccc(c(c1)[Cl])[Cl])N |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4441 |
| logD: | 3.353 |
| logSw: | -3.6318 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.853 |
| InChI Key: | MUUFPRSGUCTVLB-HNNXBMFYSA-N |