2-{[(2,4-dichlorophenyl)methyl]sulfanyl}-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole
Chemical Structure Depiction of
2-{[(2,4-dichlorophenyl)methyl]sulfanyl}-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole
2-{[(2,4-dichlorophenyl)methyl]sulfanyl}-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole
Compound characteristics
| Compound ID: | 8388-0773 |
| Compound Name: | 2-{[(2,4-dichlorophenyl)methyl]sulfanyl}-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole |
| Molecular Weight: | 330.23 |
| Molecular Formula: | C13 H13 Cl2 N3 O S |
| Smiles: | C1C[C@@H](c2nnc(o2)SCc2ccc(cc2[Cl])[Cl])NC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9698 |
| logD: | 1.0095 |
| logSw: | -2.7737 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.735 |
| InChI Key: | OOFGOWHAAIJFTN-NSHDSACASA-N |