2-{[(4-bromophenyl)methyl]sulfanyl}-5-(4-methoxyphenyl)-1,3,4-oxadiazole
Chemical Structure Depiction of
2-{[(4-bromophenyl)methyl]sulfanyl}-5-(4-methoxyphenyl)-1,3,4-oxadiazole
2-{[(4-bromophenyl)methyl]sulfanyl}-5-(4-methoxyphenyl)-1,3,4-oxadiazole
Compound characteristics
| Compound ID: | 8393-2021 |
| Compound Name: | 2-{[(4-bromophenyl)methyl]sulfanyl}-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
| Molecular Weight: | 377.26 |
| Molecular Formula: | C16 H13 Br N2 O2 S |
| Smiles: | COc1ccc(cc1)c1nnc(o1)SCc1ccc(cc1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.2207 |
| logD: | 4.2207 |
| logSw: | -4.296 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.608 |
| InChI Key: | JHQCBGXLXRBHHY-UHFFFAOYSA-N |