3-(4-ethoxyanilino)-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-(4-ethoxyanilino)-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione
3-(4-ethoxyanilino)-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8412-1020 |
| Compound Name: | 3-(4-ethoxyanilino)-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
| Molecular Weight: | 354.4 |
| Molecular Formula: | C20 H22 N2 O4 |
| Smiles: | CCOc1ccc(cc1)NC1CC(N(C1=O)c1ccc(cc1)OCC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.661 |
| logD: | 2.661 |
| logSw: | -2.8493 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.834 |
| InChI Key: | TXAZRJKPEBTSJQ-SFHVURJKSA-N |