ethyl 4-[5-oxo-7-(2-phenylethenyl)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-[5-oxo-7-(2-phenylethenyl)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carboxylate
ethyl 4-[5-oxo-7-(2-phenylethenyl)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carboxylate
Compound characteristics
| Compound ID: | 8442-0027 |
| Compound Name: | ethyl 4-[5-oxo-7-(2-phenylethenyl)-5,6,7,8-tetrahydroquinazolin-2-yl]piperazine-1-carboxylate |
| Molecular Weight: | 406.48 |
| Molecular Formula: | C23 H26 N4 O3 |
| Smiles: | CCOC(N1CCN(CC1)c1ncc2C(CC(Cc2n1)/C=C/c1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7024 |
| logD: | 3.7024 |
| logSw: | -3.8184 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.889 |
| InChI Key: | BJIDUBMJJZTWNV-GFOMBABLSA-N |