3-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(2-methoxyphenyl)propanamide
					Chemical Structure Depiction of
3-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(2-methoxyphenyl)propanamide
			3-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(2-methoxyphenyl)propanamide
Compound characteristics
| Compound ID: | 8515-4454 | 
| Compound Name: | 3-(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)-N-(2-methoxyphenyl)propanamide | 
| Molecular Weight: | 346.77 | 
| Molecular Formula: | C17 H15 Cl N2 O4 | 
| Smiles: | COc1ccccc1NC(CCN1C(=O)Oc2cc(ccc12)[Cl])=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.2484 | 
| logD: | 3.248 | 
| logSw: | -3.8945 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 53.127 | 
| InChI Key: | SMJOTWDEAWSLMM-UHFFFAOYSA-N | 
 
				 
				