2-(methanesulfonyl)-1',3'-diphenyl-5-(thiophen-2-yl)-3,4-dihydro-1'H,2H-3,4'-bipyrazole
Chemical Structure Depiction of
2-(methanesulfonyl)-1',3'-diphenyl-5-(thiophen-2-yl)-3,4-dihydro-1'H,2H-3,4'-bipyrazole
2-(methanesulfonyl)-1',3'-diphenyl-5-(thiophen-2-yl)-3,4-dihydro-1'H,2H-3,4'-bipyrazole
Compound characteristics
| Compound ID: | 8519-0016 |
| Compound Name: | 2-(methanesulfonyl)-1',3'-diphenyl-5-(thiophen-2-yl)-3,4-dihydro-1'H,2H-3,4'-bipyrazole |
| Molecular Weight: | 448.56 |
| Molecular Formula: | C23 H20 N4 O2 S2 |
| Smiles: | CS(N1C(CC(c2cccs2)=N1)c1cn(c2ccccc2)nc1c1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5952 |
| logD: | 4.5952 |
| logSw: | -4.3419 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.767 |
| InChI Key: | QLCXKXNKRZXDGY-NRFANRHFSA-N |