propan-2-yl 4-(4-ethylphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 4-(4-ethylphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate
propan-2-yl 4-(4-ethylphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate
Compound characteristics
| Compound ID: | 8525-0844 |
| Compound Name: | propan-2-yl 4-(4-ethylphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| Molecular Weight: | 375.47 |
| Molecular Formula: | C23 H25 N3 O2 |
| Smiles: | CCc1ccc(cc1)C1C(=C(C)Nc2nc3ccccc3n12)C(=O)OC(C)C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6365 |
| logD: | 5.6248 |
| logSw: | -5.464 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.467 |
| InChI Key: | OUHRORGJKJFLDZ-NRFANRHFSA-N |