propan-2-yl 4-(4-hydroxy-3-methoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 4-(4-hydroxy-3-methoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate
propan-2-yl 4-(4-hydroxy-3-methoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate
Compound characteristics
| Compound ID: | 8525-0873 |
| Compound Name: | propan-2-yl 4-(4-hydroxy-3-methoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| Molecular Weight: | 393.44 |
| Molecular Formula: | C22 H23 N3 O4 |
| Smiles: | CC(C)OC(C1C(c2ccc(c(c2)OC)O)n2c3ccccc3nc2NC=1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9516 |
| logD: | 3.94 |
| logSw: | -3.7554 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.645 |
| InChI Key: | YPEWRPKZWXTFJK-FQEVSTJZSA-N |