2-(4-chlorophenyl)-4-(4-fluorophenyl)-5H-[1]benzopyrano[4,3-b]pyridine
Chemical Structure Depiction of
2-(4-chlorophenyl)-4-(4-fluorophenyl)-5H-[1]benzopyrano[4,3-b]pyridine
2-(4-chlorophenyl)-4-(4-fluorophenyl)-5H-[1]benzopyrano[4,3-b]pyridine
Compound characteristics
| Compound ID: | 8539-0590 |
| Compound Name: | 2-(4-chlorophenyl)-4-(4-fluorophenyl)-5H-[1]benzopyrano[4,3-b]pyridine |
| Molecular Weight: | 387.84 |
| Molecular Formula: | C24 H15 Cl F N O |
| Smiles: | C1c2c(cc(c3ccc(cc3)[Cl])nc2c2ccccc2O1)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 7.2689 |
| logD: | 7.2505 |
| logSw: | -6.7343 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 17.2706 |
| InChI Key: | VLJAWRXIDIOZMY-UHFFFAOYSA-N |