3-(4-chlorophenyl)-N-(4-ethoxyphenyl)-2,1-benzoxazole-5-carboxamide
Chemical Structure Depiction of
3-(4-chlorophenyl)-N-(4-ethoxyphenyl)-2,1-benzoxazole-5-carboxamide
3-(4-chlorophenyl)-N-(4-ethoxyphenyl)-2,1-benzoxazole-5-carboxamide
Compound characteristics
| Compound ID: | 8544-0205 |
| Compound Name: | 3-(4-chlorophenyl)-N-(4-ethoxyphenyl)-2,1-benzoxazole-5-carboxamide |
| Molecular Weight: | 392.84 |
| Molecular Formula: | C22 H17 Cl N2 O3 |
| Smiles: | CCOc1ccc(cc1)NC(c1ccc2c(c1)c(c1ccc(cc1)[Cl])on2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8393 |
| logD: | 5.8392 |
| logSw: | -6.1413 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.936 |
| InChI Key: | LPELFDWIQIHNAM-UHFFFAOYSA-N |