N-(4-acetylphenyl)-5-methyl-1-(3-phenyl-2,1-benzoxazol-5-yl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
N-(4-acetylphenyl)-5-methyl-1-(3-phenyl-2,1-benzoxazol-5-yl)-1H-1,2,3-triazole-4-carboxamide
N-(4-acetylphenyl)-5-methyl-1-(3-phenyl-2,1-benzoxazol-5-yl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | 8544-0633 |
| Compound Name: | N-(4-acetylphenyl)-5-methyl-1-(3-phenyl-2,1-benzoxazol-5-yl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 437.46 |
| Molecular Formula: | C25 H19 N5 O3 |
| Smiles: | CC(c1ccc(cc1)NC(c1c(C)n(c2ccc3c(c2)c(c2ccccc2)on3)nn1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1456 |
| logD: | 4.1373 |
| logSw: | -4.2937 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.483 |
| InChI Key: | RIYJGIVJRQPDOH-UHFFFAOYSA-N |