2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide
Chemical Structure Depiction of
2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide
2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide
Compound characteristics
| Compound ID: | 8561-06399 |
| Compound Name: | 2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide |
| Molecular Weight: | 369.39 |
| Molecular Formula: | C20 H20 F N3 O3 |
| Smiles: | Cc1ccc(cc1)NC(CC1C(NCCN1C(c1ccc(cc1)F)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.0654 |
| logD: | 2.0654 |
| logSw: | -2.7717 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.315 |
| InChI Key: | WNBXOKHGOZSRKS-KRWDZBQOSA-N |