2-anilino-8-methyl-4-phenyl-1,4-dihydro-6H-pyrimido[1,2-a][1,3,5]triazin-6-one
Chemical Structure Depiction of
2-anilino-8-methyl-4-phenyl-1,4-dihydro-6H-pyrimido[1,2-a][1,3,5]triazin-6-one
2-anilino-8-methyl-4-phenyl-1,4-dihydro-6H-pyrimido[1,2-a][1,3,5]triazin-6-one
Compound characteristics
| Compound ID: | 8561-08507 |
| Compound Name: | 2-anilino-8-methyl-4-phenyl-1,4-dihydro-6H-pyrimido[1,2-a][1,3,5]triazin-6-one |
| Molecular Weight: | 331.38 |
| Molecular Formula: | C19 H17 N5 O |
| Smiles: | CC1=CC(N2C(c3ccccc3)N=C(NC2=N1)Nc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9996 |
| logD: | 0.9289 |
| logSw: | -3.3626 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.471 |
| InChI Key: | BQSRJWKQNMOFTF-QGZVFWFLSA-N |