N-(2,5-dimethoxyphenyl)-2-(4-ethyl-2-oxomorpholin-3-yl)acetamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-2-(4-ethyl-2-oxomorpholin-3-yl)acetamide
N-(2,5-dimethoxyphenyl)-2-(4-ethyl-2-oxomorpholin-3-yl)acetamide
Compound characteristics
| Compound ID: | 8563-1162 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-2-(4-ethyl-2-oxomorpholin-3-yl)acetamide |
| Molecular Weight: | 322.36 |
| Molecular Formula: | C16 H22 N2 O5 |
| Smiles: | CCN1CCOC(C1CC(Nc1cc(ccc1OC)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.2085 |
| logD: | 1.1656 |
| logSw: | -2.173 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.745 |
| InChI Key: | XDNJXDCMQBSIPW-ZDUSSCGKSA-N |