N-(3-methylphenyl)-2-(2-oxo-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetamide
Chemical Structure Depiction of
N-(3-methylphenyl)-2-(2-oxo-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetamide
N-(3-methylphenyl)-2-(2-oxo-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetamide
Compound characteristics
| Compound ID: | 8563-1209 |
| Compound Name: | N-(3-methylphenyl)-2-(2-oxo-3,4-dihydro-2H-1,4-benzoxazin-3-yl)acetamide |
| Molecular Weight: | 296.32 |
| Molecular Formula: | C17 H16 N2 O3 |
| Smiles: | Cc1cccc(c1)NC(CC1C(=O)Oc2ccccc2N1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5852 |
| logD: | 2.5851 |
| logSw: | -3.0487 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.291 |
| InChI Key: | WPDRRLRCCIWCEV-AWEZNQCLSA-N |