N-(4-acetamidophenyl)-3-[5-(4-chlorophenyl)furan-2-yl]propanamide
Chemical Structure Depiction of
N-(4-acetamidophenyl)-3-[5-(4-chlorophenyl)furan-2-yl]propanamide
N-(4-acetamidophenyl)-3-[5-(4-chlorophenyl)furan-2-yl]propanamide
Compound characteristics
| Compound ID: | 8582-1419 |
| Compound Name: | N-(4-acetamidophenyl)-3-[5-(4-chlorophenyl)furan-2-yl]propanamide |
| Molecular Weight: | 382.85 |
| Molecular Formula: | C21 H19 Cl N2 O3 |
| Smiles: | CC(Nc1ccc(cc1)NC(CCc1ccc(c2ccc(cc2)[Cl])o1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1426 |
| logD: | 4.1426 |
| logSw: | -4.4074 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.948 |
| InChI Key: | AUVKCRVWYLZLGP-UHFFFAOYSA-N |