N-[4-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)phenyl]acetamide
Chemical Structure Depiction of
N-[4-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)phenyl]acetamide
N-[4-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)phenyl]acetamide
Compound characteristics
| Compound ID: | 8601-0164 |
| Compound Name: | N-[4-({1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}methoxy)phenyl]acetamide |
| Molecular Weight: | 377.32 |
| Molecular Formula: | C17 H14 F3 N5 O2 |
| Smiles: | CC(Nc1ccc(cc1)OCc1nnnn1c1cccc(c1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6442 |
| logD: | 2.6442 |
| logSw: | -3.2251 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.044 |
| InChI Key: | LSBJDYMZOJHWFQ-UHFFFAOYSA-N |