methyl 2-benzamido-N-benzoyl-3,3,3-trifluoroalaninate
Chemical Structure Depiction of
methyl 2-benzamido-N-benzoyl-3,3,3-trifluoroalaninate
methyl 2-benzamido-N-benzoyl-3,3,3-trifluoroalaninate
Compound characteristics
| Compound ID: | 8602-0463 |
| Compound Name: | methyl 2-benzamido-N-benzoyl-3,3,3-trifluoroalaninate |
| Molecular Weight: | 380.32 |
| Molecular Formula: | C18 H15 F3 N2 O4 |
| Smiles: | COC(C(C(F)(F)F)(NC(c1ccccc1)=O)NC(c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7595 |
| logD: | 0.1845 |
| logSw: | -3.2458 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.88 |
| InChI Key: | LCPZONFLGQEQEM-UHFFFAOYSA-N |