3-(diethylamino)-1-(3-nitrophenyl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-(diethylamino)-1-(3-nitrophenyl)pyrrolidine-2,5-dione
3-(diethylamino)-1-(3-nitrophenyl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8645-0057 |
| Compound Name: | 3-(diethylamino)-1-(3-nitrophenyl)pyrrolidine-2,5-dione |
| Molecular Weight: | 291.3 |
| Molecular Formula: | C14 H17 N3 O4 |
| Smiles: | CCN(CC)C1CC(N(C1=O)c1cccc(c1)[N+]([O-])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.7855 |
| logD: | 0.7851 |
| logSw: | -1.7347 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 64.653 |
| InChI Key: | ZRRXXXGBVDGATC-GFCCVEGCSA-N |