2-{[(3-chlorophenyl)methyl]sulfanyl}-N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
2-{[(3-chlorophenyl)methyl]sulfanyl}-N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxamide
2-{[(3-chlorophenyl)methyl]sulfanyl}-N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | A0015636 |
| Compound Name: | 2-{[(3-chlorophenyl)methyl]sulfanyl}-N-(3,5-dimethylphenyl)-4-oxo-3-phenyl-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 526.06 |
| Molecular Formula: | C30 H24 Cl N3 O2 S |
| Smiles: | Cc1cc(C)cc(c1)NC(c1ccc2C(N(C(=Nc2c1)SCc1cccc(c1)[Cl])c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.5552 |
| logD: | 6.5552 |
| logSw: | -6.075 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.251 |
| InChI Key: | ZHLWAFNZVAHNGM-UHFFFAOYSA-N |