N-(4-ethoxyphenyl)-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1,2,3,4-tetrahydroquinazoline-7-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1,2,3,4-tetrahydroquinazoline-7-carboxamide
N-(4-ethoxyphenyl)-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1,2,3,4-tetrahydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | A0061572 |
| Compound Name: | N-(4-ethoxyphenyl)-3-(2-fluorophenyl)-4-oxo-2-sulfanylidene-1,2,3,4-tetrahydroquinazoline-7-carboxamide |
| Molecular Weight: | 435.48 |
| Molecular Formula: | C23 H18 F N3 O3 S |
| Smiles: | CCOc1ccc(cc1)NC(c1ccc2C(N(C(Nc2c1)=S)c1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2382 |
| logD: | 3.9159 |
| logSw: | -4.1874 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.62 |
| InChI Key: | BMRIOCYCAKYZSW-UHFFFAOYSA-N |