ethyl 4-(3-chloro-4-methoxyanilino)-7-(trifluoromethyl)quinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 4-(3-chloro-4-methoxyanilino)-7-(trifluoromethyl)quinoline-3-carboxylate
ethyl 4-(3-chloro-4-methoxyanilino)-7-(trifluoromethyl)quinoline-3-carboxylate
Compound characteristics
| Compound ID: | C053-0296 |
| Compound Name: | ethyl 4-(3-chloro-4-methoxyanilino)-7-(trifluoromethyl)quinoline-3-carboxylate |
| Molecular Weight: | 424.81 |
| Molecular Formula: | C20 H16 Cl F3 N2 O3 |
| Smiles: | CCOC(c1cnc2cc(ccc2c1Nc1ccc(c(c1)[Cl])OC)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6513 |
| logD: | 5.6513 |
| logSw: | -6.0374 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.992 |
| InChI Key: | AJPDXNCKZRBBPF-UHFFFAOYSA-N |