ethyl 4-(3-chloro-4-fluoroanilino)-8-methoxyquinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 4-(3-chloro-4-fluoroanilino)-8-methoxyquinoline-3-carboxylate
ethyl 4-(3-chloro-4-fluoroanilino)-8-methoxyquinoline-3-carboxylate
Compound characteristics
| Compound ID: | C053-0432 |
| Compound Name: | ethyl 4-(3-chloro-4-fluoroanilino)-8-methoxyquinoline-3-carboxylate |
| Molecular Weight: | 374.8 |
| Molecular Formula: | C19 H16 Cl F N2 O3 |
| Smiles: | CCOC(c1cnc2c(cccc2c1Nc1ccc(c(c1)[Cl])F)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7751 |
| logD: | 4.775 |
| logSw: | -4.9471 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.762 |
| InChI Key: | WZVVTEXLZGUNMO-UHFFFAOYSA-N |