N-(4-methoxy-1,3-benzothiazol-2-yl)-4-(morpholine-4-sulfonyl)benzamide
Chemical Structure Depiction of
N-(4-methoxy-1,3-benzothiazol-2-yl)-4-(morpholine-4-sulfonyl)benzamide
N-(4-methoxy-1,3-benzothiazol-2-yl)-4-(morpholine-4-sulfonyl)benzamide
Compound characteristics
| Compound ID: | C059-0019 |
| Compound Name: | N-(4-methoxy-1,3-benzothiazol-2-yl)-4-(morpholine-4-sulfonyl)benzamide |
| Molecular Weight: | 433.5 |
| Molecular Formula: | C19 H19 N3 O5 S2 |
| Smiles: | COc1cccc2c1nc(NC(c1ccc(cc1)S(N1CCOCC1)(=O)=O)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 2.863 |
| logD: | 2.8607 |
| logSw: | -3.5654 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.111 |
| InChI Key: | FZNKDVDFHGPRQZ-UHFFFAOYSA-N |