N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)-3-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)-3-(trifluoromethyl)benzamide
N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)-3-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | C064-0238 |
| Compound Name: | N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)-3-(trifluoromethyl)benzamide |
| Molecular Weight: | 468.54 |
| Molecular Formula: | C26 H23 F3 N2 O S |
| Smiles: | CC(c1ccccc1)Sc1cn(CCNC(c2cccc(c2)C(F)(F)F)=O)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1981 |
| logD: | 6.1981 |
| logSw: | -5.8156 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.2038 |
| InChI Key: | HAXGPQDQSBCGSB-SFHVURJKSA-N |