N-[2-(3-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-indol-1-yl)ethyl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-(3-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-indol-1-yl)ethyl]thiophene-2-carboxamide
N-[2-(3-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-indol-1-yl)ethyl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | C064-0437 |
| Compound Name: | N-[2-(3-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1H-indol-1-yl)ethyl]thiophene-2-carboxamide |
| Molecular Weight: | 463.62 |
| Molecular Formula: | C25 H25 N3 O2 S2 |
| Smiles: | Cc1cc(C)cc(c1)NC(CSc1cn(CCNC(c2cccs2)=O)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6184 |
| logD: | 4.6184 |
| logSw: | -4.1156 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.371 |
| InChI Key: | KRCNZCADMXMCHO-UHFFFAOYSA-N |