3,4-dimethoxy-N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)benzamide
Chemical Structure Depiction of
3,4-dimethoxy-N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)benzamide
3,4-dimethoxy-N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)benzamide
Compound characteristics
| Compound ID: | C064-0466 |
| Compound Name: | 3,4-dimethoxy-N-(2-{3-[(1-phenylethyl)sulfanyl]-1H-indol-1-yl}ethyl)benzamide |
| Molecular Weight: | 460.59 |
| Molecular Formula: | C27 H28 N2 O3 S |
| Smiles: | CC(c1ccccc1)Sc1cn(CCNC(c2ccc(c(c2)OC)OC)=O)c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0188 |
| logD: | 5.0188 |
| logSw: | -4.7506 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.465 |
| InChI Key: | SQHMUMXHVYVSIE-IBGZPJMESA-N |