3-(3-chloro-4-methoxyphenyl)-N-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide
Chemical Structure Depiction of
3-(3-chloro-4-methoxyphenyl)-N-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide
3-(3-chloro-4-methoxyphenyl)-N-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide
Compound characteristics
| Compound ID: | C066-0410 |
| Compound Name: | 3-(3-chloro-4-methoxyphenyl)-N-(2-{[(3-fluorophenyl)methyl]amino}-2-oxoethyl)-4-oxo-3,4-dihydrophthalazine-1-carboxamide |
| Molecular Weight: | 494.91 |
| Molecular Formula: | C25 H20 Cl F N4 O4 |
| Smiles: | COc1ccc(cc1[Cl])N1C(c2ccccc2C(C(NCC(NCc2cccc(c2)F)=O)=O)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6571 |
| logD: | 3.657 |
| logSw: | -4.0435 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.563 |
| InChI Key: | RVTSODYEGGIYOD-UHFFFAOYSA-N |