2-cyclohexyl-3-(4-methoxyphenyl)-1-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydroisoquinoline-4-carboxamide
Chemical Structure Depiction of
2-cyclohexyl-3-(4-methoxyphenyl)-1-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydroisoquinoline-4-carboxamide
2-cyclohexyl-3-(4-methoxyphenyl)-1-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydroisoquinoline-4-carboxamide
Compound characteristics
| Compound ID: | C066-0624 |
| Compound Name: | 2-cyclohexyl-3-(4-methoxyphenyl)-1-oxo-N-[4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
| Molecular Weight: | 522.57 |
| Molecular Formula: | C30 H29 F3 N2 O3 |
| Smiles: | COc1ccc(cc1)C1C(C(Nc2ccc(cc2)C(F)(F)F)=O)c2ccccc2C(N1C1CCCCC1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.5122 |
| logD: | 6.5121 |
| logSw: | -5.6369 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.508 |
| InChI Key: | QZOLNDOXOGQSCF-UHFFFAOYSA-N |