6-(4-methoxyphenyl)-5-(4-methylpiperidine-1-carbonyl)-1-(3,4,5-trimethoxyphenyl)piperidin-2-one
Chemical Structure Depiction of
6-(4-methoxyphenyl)-5-(4-methylpiperidine-1-carbonyl)-1-(3,4,5-trimethoxyphenyl)piperidin-2-one
6-(4-methoxyphenyl)-5-(4-methylpiperidine-1-carbonyl)-1-(3,4,5-trimethoxyphenyl)piperidin-2-one
Compound characteristics
| Compound ID: | C066-1335 |
| Compound Name: | 6-(4-methoxyphenyl)-5-(4-methylpiperidine-1-carbonyl)-1-(3,4,5-trimethoxyphenyl)piperidin-2-one |
| Molecular Weight: | 496.6 |
| Molecular Formula: | C28 H36 N2 O6 |
| Smiles: | CC1CCN(CC1)C(C1CCC(N(C1c1ccc(cc1)OC)c1cc(c(c(c1)OC)OC)OC)=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6948 |
| logD: | 3.6948 |
| logSw: | -4.2205 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 62.759 |
| InChI Key: | HQBSWCPEVYXMOQ-UHFFFAOYSA-N |