N-(2,5-dimethylphenyl)-N-methyl-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-N-methyl-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
N-(2,5-dimethylphenyl)-N-methyl-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide
Compound characteristics
| Compound ID: | C066-1837 |
| Compound Name: | N-(2,5-dimethylphenyl)-N-methyl-4-oxo-4H-thieno[3,2-c][1]benzopyran-2-carboxamide |
| Molecular Weight: | 363.43 |
| Molecular Formula: | C21 H17 N O3 S |
| Smiles: | Cc1ccc(C)c(c1)N(C)C(c1cc2C(=O)Oc3ccccc3c2s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1152 |
| logD: | 5.1152 |
| logSw: | -5.0589 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.975 |
| InChI Key: | WHANBEXJVVFGTH-UHFFFAOYSA-N |