2-chloro-7-methoxyquinoline-3-carbaldehyde
Chemical Structure Depiction of
2-chloro-7-methoxyquinoline-3-carbaldehyde
2-chloro-7-methoxyquinoline-3-carbaldehyde
Compound characteristics
| Compound ID: | C066-2527 |
| Compound Name: | 2-chloro-7-methoxyquinoline-3-carbaldehyde |
| Molecular Weight: | 221.64 |
| Molecular Formula: | C11 H8 Cl N O2 |
| Smiles: | COc1ccc2cc(C=O)c(nc2c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.6736 |
| logD: | 2.6736 |
| logSw: | -3.3211 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.9095 |
| InChI Key: | WRXZCLBKDXISQA-UHFFFAOYSA-N |