7-chloro-N-cyclohexyl-5-methyl-4-oxo-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide
Chemical Structure Depiction of
7-chloro-N-cyclohexyl-5-methyl-4-oxo-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide
7-chloro-N-cyclohexyl-5-methyl-4-oxo-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide
Compound characteristics
| Compound ID: | C066-2897 |
| Compound Name: | 7-chloro-N-cyclohexyl-5-methyl-4-oxo-4,5-dihydrothieno[3,2-c]quinoline-2-carboxamide |
| Molecular Weight: | 374.89 |
| Molecular Formula: | C19 H19 Cl N2 O2 S |
| Smiles: | CN1C(c2cc(C(NC3CCCCC3)=O)sc2c2ccc(cc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6079 |
| logD: | 4.6079 |
| logSw: | -4.7059 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.264 |
| InChI Key: | HWILATRKNDSCJC-UHFFFAOYSA-N |