N-{3-[butyl(ethyl)amino]propyl}-2-[3-(4-chlorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]acetamide
Chemical Structure Depiction of
N-{3-[butyl(ethyl)amino]propyl}-2-[3-(4-chlorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]acetamide
N-{3-[butyl(ethyl)amino]propyl}-2-[3-(4-chlorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]acetamide
Compound characteristics
| Compound ID: | C066-4619 |
| Compound Name: | N-{3-[butyl(ethyl)amino]propyl}-2-[3-(4-chlorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]acetamide |
| Molecular Weight: | 445.95 |
| Molecular Formula: | C22 H28 Cl N5 O3 |
| Smiles: | CCCCN(CC)CCCNC(CN1C=Nc2c(C1=O)c(c1ccc(cc1)[Cl])no2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5005 |
| logD: | -0.2501 |
| logSw: | -3.6977 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.951 |
| InChI Key: | SNVFEHRNLUNPLQ-UHFFFAOYSA-N |