ethyl 5-{2-[(2-methoxyethyl)amino]-2-oxoethyl}-6-methyl-4-oxo-4,5-dihydro[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate
Chemical Structure Depiction of
ethyl 5-{2-[(2-methoxyethyl)amino]-2-oxoethyl}-6-methyl-4-oxo-4,5-dihydro[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate
ethyl 5-{2-[(2-methoxyethyl)amino]-2-oxoethyl}-6-methyl-4-oxo-4,5-dihydro[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate
Compound characteristics
| Compound ID: | C066-5188 |
| Compound Name: | ethyl 5-{2-[(2-methoxyethyl)amino]-2-oxoethyl}-6-methyl-4-oxo-4,5-dihydro[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylate |
| Molecular Weight: | 338.32 |
| Molecular Formula: | C14 H18 N4 O6 |
| Smiles: | CCOC(c1c2C(N(CC(NCCOC)=O)C(C)=Nc2on1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | -0.6766 |
| logD: | -0.6766 |
| logSw: | -0.3428 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 99.701 |
| InChI Key: | SOIUSBGEMZEXLQ-UHFFFAOYSA-N |