[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol
Chemical Structure Depiction of
[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol
[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol
Compound characteristics
| Compound ID: | C066-5287 |
| Compound Name: | [3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methanethiol |
| Molecular Weight: | 252.29 |
| Molecular Formula: | C11 H12 N2 O3 S |
| Smiles: | COc1ccc(cc1OC)c1nc(CS)on1 |
| Stereo: | ACHIRAL |
| logP: | 2.6443 |
| logD: | 2.6314 |
| logSw: | -2.8482 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.842 |
| InChI Key: | POMRLUBEKYKYJW-UHFFFAOYSA-N |