2-[(4-chlorophenyl)sulfanyl]-N-(2,2-dimethoxyethyl)quinoline-4-carboxamide
Chemical Structure Depiction of
2-[(4-chlorophenyl)sulfanyl]-N-(2,2-dimethoxyethyl)quinoline-4-carboxamide
2-[(4-chlorophenyl)sulfanyl]-N-(2,2-dimethoxyethyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | C072-0217 |
| Compound Name: | 2-[(4-chlorophenyl)sulfanyl]-N-(2,2-dimethoxyethyl)quinoline-4-carboxamide |
| Molecular Weight: | 402.9 |
| Molecular Formula: | C20 H19 Cl N2 O3 S |
| Smiles: | COC(CNC(c1cc(nc2ccccc12)Sc1ccc(cc1)[Cl])=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.5122 |
| logD: | 4.5122 |
| logSw: | -4.6963 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.838 |
| InChI Key: | POILSYAGOCENAE-UHFFFAOYSA-N |